C26H25NO6 — CID 1223278
[3-acetyl-1-[2-(3,4-dimethoxyphenyl)ethyl]-2-methylindol-5-yl] furan-2-carboxylate (PubChem CID 1223278) has the molecular formula C26H25NO6 and a molecular weight of 447.49 g/mol. Its IUPAC name is [3-acetyl-1-[2-(3,4-dimethoxyphenyl)ethyl]-2-methylindol-5-yl] furan-2-carboxylate.
| Compound Name | [3-acetyl-1-[2-(3,4-dimethoxyphenyl)ethyl]-2-methylindol-5-yl] furan-2-carboxylate |
|---|---|
| PubChem CID | 1223278 |
| Molecular Formula | C26H25NO6 |
| Molecular Weight | 447.49 g/mol |
| Exact Mass | 447.17 |
| IUPAC Name | [3-acetyl-1-[2-(3,4-dimethoxyphenyl)ethyl]-2-methylindol-5-yl] furan-2-carboxylate |
| SMILES | COc1ccc(CCn2c(C)c(C(C)=O)c3cc(OC(=O)c4ccco4)ccc32)cc1OC |
| InChI | InChI=1S/C26H25NO6/c1-16-25(17(2)28)20-15-19(33-26(29)23-6-5-13-32-23)8-9-21(20)27(16)12-11-18-7-10-22(30-3)24(14-18)31-4/h5-10,13-15H,11-12H2,1-4H3 |
| InChIKey | FIQXWJKFHPGRSD-UHFFFAOYSA-N |
| XLogP | 5.22 |
| TPSA | 79.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.49 |
| LogP ≤ 5 | 5.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|