C19H17N3O2S — CID 122329221
3-[2-oxo-2-(2-phenyl-1,3-thiazolidin-3-yl)ethyl]quinazolin-4-one (PubChem CID 122329221) has the molecular formula C19H17N3O2S and a molecular weight of 351.43 g/mol. Its IUPAC name is 3-[2-oxo-2-(2-phenyl-1,3-thiazolidin-3-yl)ethyl]quinazolin-4-one.
| Compound Name | 3-[2-oxo-2-(2-phenyl-1,3-thiazolidin-3-yl)ethyl]quinazolin-4-one |
|---|---|
| PubChem CID | 122329221 |
| Molecular Formula | C19H17N3O2S |
| Molecular Weight | 351.43 g/mol |
| Exact Mass | 351.10 |
| IUPAC Name | 3-[2-oxo-2-(2-phenyl-1,3-thiazolidin-3-yl)ethyl]quinazolin-4-one |
| SMILES | O=C(Cn1cnc2ccccc2c1=O)N1CCSC1c1ccccc1 |
| InChI | InChI=1S/C19H17N3O2S/c23-17(22-10-11-25-19(22)14-6-2-1-3-7-14)12-21-13-20-16-9-5-4-8-15(16)18(21)24/h1-9,13,19H,10-12H2 |
| InChIKey | HLTQHZNRZIIWHA-UHFFFAOYSA-N |
| XLogP | 2.67 |
| TPSA | 55.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.43 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |