C16H11ClF3NOS — CID 122329376
[2-(2-chlorophenyl)-1,3-thiazolidin-3-yl]-(2,3,4-trifluorophenyl)methanone (PubChem CID 122329376) has the molecular formula C16H11ClF3NOS and a molecular weight of 357.78 g/mol. Its IUPAC name is [2-(2-chlorophenyl)-1,3-thiazolidin-3-yl]-(2,3,4-trifluorophenyl)methanone.
| Compound Name | [2-(2-chlorophenyl)-1,3-thiazolidin-3-yl]-(2,3,4-trifluorophenyl)methanone |
|---|---|
| PubChem CID | 122329376 |
| Molecular Formula | C16H11ClF3NOS |
| Molecular Weight | 357.78 g/mol |
| Exact Mass | 357.02 |
| IUPAC Name | [2-(2-chlorophenyl)-1,3-thiazolidin-3-yl]-(2,3,4-trifluorophenyl)methanone |
| SMILES | O=C(c1ccc(F)c(F)c1F)N1CCSC1c1ccccc1Cl |
| InChI | InChI=1S/C16H11ClF3NOS/c17-11-4-2-1-3-9(11)16-21(7-8-23-16)15(22)10-5-6-12(18)14(20)13(10)19/h1-6,16H,7-8H2 |
| InChIKey | ZOFCLKIIXJDKMD-UHFFFAOYSA-N |
| XLogP | 4.65 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.78 |
| LogP ≤ 5 | 4.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|