About 4-[[2-(4-chlorophenyl)-1,3-thiazolidin-3-yl]sulfonyl]-1,2-oxazole
4-[[2-(4-chlorophenyl)-1,3-thiazolidin-3-yl]sulfonyl]-1,2-oxazole (PubChem CID 122329632) has the molecular formula C12H11ClN2O3S2
and a molecular weight of 330.82 g/mol. Its IUPAC name is 4-[[2-(4-chlorophenyl)-1,3-thiazolidin-3-yl]sulfonyl]-1,2-oxazole.
Molecular Properties
| Compound Name | 4-[[2-(4-chlorophenyl)-1,3-thiazolidin-3-yl]sulfonyl]-1,2-oxazole |
| PubChem CID | 122329632 |
| Molecular Formula | C12H11ClN2O3S2 |
| Molecular Weight | 330.82 g/mol |
| Exact Mass | 329.99 |
| IUPAC Name | 4-[[2-(4-chlorophenyl)-1,3-thiazolidin-3-yl]sulfonyl]-1,2-oxazole |
| SMILES | O=S(=O)(c1cnoc1)N1CCSC1c1ccc(Cl)cc1 |
| InChI | InChI=1S/C12H11ClN2O3S2/c13-10-3-1-9(2-4-10)12-15(5-6-19-12)20(16,17)11-7-14-18-8-11/h1-4,7-8,12H,5-6H2 |
| InChIKey | LYRKRSPHOGTNSP-UHFFFAOYSA-N |
| XLogP | 2.76 |
| TPSA | 63.41 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 330.82 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 4-[[2-(4-chlorophenyl)-1,3-thiazolidin-3-yl]sulfonyl]-1,2-oxazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[[2-(4-chlorophenyl)-1,3-thiazolidin-3-yl]sulfonyl]-1,2-oxazole?
The IUPAC name of 4-[[2-(4-chlorophenyl)-1,3-thiazolidin-3-yl]sulfonyl]-1,2-oxazole (CID 122329632) is 4-[[2-(4-chlorophenyl)-1,3-thiazolidin-3-yl]sulfonyl]-1,2-oxazole.
What is the SMILES notation for 4-[[2-(4-chlorophenyl)-1,3-thiazolidin-3-yl]sulfonyl]-1,2-oxazole?
The canonical SMILES for 4-[[2-(4-chlorophenyl)-1,3-thiazolidin-3-yl]sulfonyl]-1,2-oxazole is O=S(=O)(c1cnoc1)N1CCSC1c1ccc(Cl)cc1.
What is the InChIKey of 4-[[2-(4-chlorophenyl)-1,3-thiazolidin-3-yl]sulfonyl]-1,2-oxazole?
The InChIKey is LYRKRSPHOGTNSP-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H11ClN2O3S2/c13-10-3-1-9(2-4-10)12-15(5-6-19-12)20(16,17)11-7-14-18-8-11/h1-4,7-8,12H,5-6H2.
What are the key properties of 4-[[2-(4-chlorophenyl)-1,3-thiazolidin-3-yl]sulfonyl]-1,2-oxazole?
4-[[2-(4-chlorophenyl)-1,3-thiazolidin-3-yl]sulfonyl]-1,2-oxazole has a molecular weight of 330.82 g/mol, XLogP of 2.76, 3 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[[2-(4-chlorophenyl)-1,3-thiazolidin-3-yl]sulfonyl]-1,2-oxazole is sourced from PubChem (CID 122329632), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).