About 2-[[2-(4-chlorophenyl)-1,3-thiazolidin-3-yl]sulfonyl]benzonitrile
2-[[2-(4-chlorophenyl)-1,3-thiazolidin-3-yl]sulfonyl]benzonitrile (PubChem CID 122329645) has the molecular formula C16H13ClN2O2S2
and a molecular weight of 364.88 g/mol. Its IUPAC name is 2-[[2-(4-chlorophenyl)-1,3-thiazolidin-3-yl]sulfonyl]benzonitrile.
Molecular Properties
| Compound Name | 2-[[2-(4-chlorophenyl)-1,3-thiazolidin-3-yl]sulfonyl]benzonitrile |
| PubChem CID | 122329645 |
| Molecular Formula | C16H13ClN2O2S2 |
| Molecular Weight | 364.88 g/mol |
| Exact Mass | 364.01 |
| IUPAC Name | 2-[[2-(4-chlorophenyl)-1,3-thiazolidin-3-yl]sulfonyl]benzonitrile |
| SMILES | N#Cc1ccccc1S(=O)(=O)N1CCSC1c1ccc(Cl)cc1 |
| InChI | InChI=1S/C16H13ClN2O2S2/c17-14-7-5-12(6-8-14)16-19(9-10-22-16)23(20,21)15-4-2-1-3-13(15)11-18/h1-8,16H,9-10H2 |
| InChIKey | QQYPWAHGLVARCF-UHFFFAOYSA-N |
| XLogP | 3.65 |
| TPSA | 61.17 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 364.88 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-[[2-(4-chlorophenyl)-1,3-thiazolidin-3-yl]sulfonyl]benzonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[[2-(4-chlorophenyl)-1,3-thiazolidin-3-yl]sulfonyl]benzonitrile?
The IUPAC name of 2-[[2-(4-chlorophenyl)-1,3-thiazolidin-3-yl]sulfonyl]benzonitrile (CID 122329645) is 2-[[2-(4-chlorophenyl)-1,3-thiazolidin-3-yl]sulfonyl]benzonitrile.
What is the SMILES notation for 2-[[2-(4-chlorophenyl)-1,3-thiazolidin-3-yl]sulfonyl]benzonitrile?
The canonical SMILES for 2-[[2-(4-chlorophenyl)-1,3-thiazolidin-3-yl]sulfonyl]benzonitrile is N#Cc1ccccc1S(=O)(=O)N1CCSC1c1ccc(Cl)cc1.
What is the InChIKey of 2-[[2-(4-chlorophenyl)-1,3-thiazolidin-3-yl]sulfonyl]benzonitrile?
The InChIKey is QQYPWAHGLVARCF-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H13ClN2O2S2/c17-14-7-5-12(6-8-14)16-19(9-10-22-16)23(20,21)15-4-2-1-3-13(15)11-18/h1-8,16H,9-10H2.
What are the key properties of 2-[[2-(4-chlorophenyl)-1,3-thiazolidin-3-yl]sulfonyl]benzonitrile?
2-[[2-(4-chlorophenyl)-1,3-thiazolidin-3-yl]sulfonyl]benzonitrile has a molecular weight of 364.88 g/mol, XLogP of 3.65, 3 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[[2-(4-chlorophenyl)-1,3-thiazolidin-3-yl]sulfonyl]benzonitrile is sourced from PubChem (CID 122329645), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).