C21H21N3O5S — CID 122329707
1-(3-methoxyphenyl)-4-[2-(4-nitrophenyl)-1,3-thiazolidine-3-carbonyl]pyrrolidin-2-one (PubChem CID 122329707) has the molecular formula C21H21N3O5S and a molecular weight of 427.48 g/mol. Its IUPAC name is 1-(3-methoxyphenyl)-4-[2-(4-nitrophenyl)-1,3-thiazolidine-3-carbonyl]pyrrolidin-2-one.
| Compound Name | 1-(3-methoxyphenyl)-4-[2-(4-nitrophenyl)-1,3-thiazolidine-3-carbonyl]pyrrolidin-2-one |
|---|---|
| PubChem CID | 122329707 |
| Molecular Formula | C21H21N3O5S |
| Molecular Weight | 427.48 g/mol |
| Exact Mass | 427.12 |
| IUPAC Name | 1-(3-methoxyphenyl)-4-[2-(4-nitrophenyl)-1,3-thiazolidine-3-carbonyl]pyrrolidin-2-one |
| SMILES | COc1cccc(N2CC(C(=O)N3CCSC3c3ccc([N+](=O)[O-])cc3)CC2=O)c1 |
| InChI | InChI=1S/C21H21N3O5S/c1-29-18-4-2-3-17(12-18)23-13-15(11-19(23)25)20(26)22-9-10-30-21(22)14-5-7-16(8-6-14)24(27)28/h2-8,12,15,21H,9-11,13H2,1H3 |
| InChIKey | QMEPAIOQJKZANZ-UHFFFAOYSA-N |
| XLogP | 3.23 |
| TPSA | 92.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.48 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|