C21H20BrN5O2 — CID 122332518
(5-bromo-3-pyridinyl)-[4-(2-methyl-6-phenoxypyrimidin-4-yl)piperazin-1-yl]methanone (PubChem CID 122332518) has the molecular formula C21H20BrN5O2 and a molecular weight of 454.33 g/mol. Its IUPAC name is (5-bromo-3-pyridinyl)-[4-(2-methyl-6-phenoxypyrimidin-4-yl)piperazin-1-yl]methanone.
| Compound Name | (5-bromo-3-pyridinyl)-[4-(2-methyl-6-phenoxypyrimidin-4-yl)piperazin-1-yl]methanone |
|---|---|
| PubChem CID | 122332518 |
| Molecular Formula | C21H20BrN5O2 |
| Molecular Weight | 454.33 g/mol |
| Exact Mass | 453.08 |
| IUPAC Name | (5-bromo-3-pyridinyl)-[4-(2-methyl-6-phenoxypyrimidin-4-yl)piperazin-1-yl]methanone |
| SMILES | Cc1nc(Oc2ccccc2)cc(N2CCN(C(=O)c3cncc(Br)c3)CC2)n1 |
| InChI | InChI=1S/C21H20BrN5O2/c1-15-24-19(12-20(25-15)29-18-5-3-2-4-6-18)26-7-9-27(10-8-26)21(28)16-11-17(22)14-23-13-16/h2-6,11-14H,7-10H2,1H3 |
| InChIKey | NJPXXIYJEYGZOA-UHFFFAOYSA-N |
| XLogP | 3.70 |
| TPSA | 71.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.33 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |