C18H29N5O — CID 122334043
3-cyclopentyl-1-[4-[6-(dimethylamino)pyridazin-3-yl]piperazin-1-yl]propan-1-one (PubChem CID 122334043) has the molecular formula C18H29N5O and a molecular weight of 331.46 g/mol. Its IUPAC name is 3-cyclopentyl-1-[4-[6-(dimethylamino)pyridazin-3-yl]piperazin-1-yl]propan-1-one.
| Compound Name | 3-cyclopentyl-1-[4-[6-(dimethylamino)pyridazin-3-yl]piperazin-1-yl]propan-1-one |
|---|---|
| PubChem CID | 122334043 |
| Molecular Formula | C18H29N5O |
| Molecular Weight | 331.46 g/mol |
| Exact Mass | 331.24 |
| IUPAC Name | 3-cyclopentyl-1-[4-[6-(dimethylamino)pyridazin-3-yl]piperazin-1-yl]propan-1-one |
| SMILES | CN(C)c1ccc(N2CCN(C(=O)CCC3CCCC3)CC2)nn1 |
| InChI | InChI=1S/C18H29N5O/c1-21(2)16-8-9-17(20-19-16)22-11-13-23(14-12-22)18(24)10-7-15-5-3-4-6-15/h8-9,15H,3-7,10-14H2,1-2H3 |
| InChIKey | RPWNISGXRIOGGC-UHFFFAOYSA-N |
| XLogP | 2.16 |
| TPSA | 52.57 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.46 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |