C18H27N5O2 — CID 122334392
oxan-4-yl-[4-(6-pyrrolidin-1-ylpyridazin-3-yl)piperazin-1-yl]methanone (PubChem CID 122334392) has the molecular formula C18H27N5O2 and a molecular weight of 345.45 g/mol. Its IUPAC name is oxan-4-yl-[4-(6-pyrrolidin-1-ylpyridazin-3-yl)piperazin-1-yl]methanone.
| Compound Name | oxan-4-yl-[4-(6-pyrrolidin-1-ylpyridazin-3-yl)piperazin-1-yl]methanone |
|---|---|
| PubChem CID | 122334392 |
| Molecular Formula | C18H27N5O2 |
| Molecular Weight | 345.45 g/mol |
| Exact Mass | 345.22 |
| IUPAC Name | oxan-4-yl-[4-(6-pyrrolidin-1-ylpyridazin-3-yl)piperazin-1-yl]methanone |
| SMILES | O=C(C1CCOCC1)N1CCN(c2ccc(N3CCCC3)nn2)CC1 |
| InChI | InChI=1S/C18H27N5O2/c24-18(15-5-13-25-14-6-15)23-11-9-22(10-12-23)17-4-3-16(19-20-17)21-7-1-2-8-21/h3-4,15H,1-2,5-14H2 |
| InChIKey | ZARZBAQEHBZOQO-UHFFFAOYSA-N |
| XLogP | 1.15 |
| TPSA | 61.80 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.45 |
| LogP ≤ 5 | 1.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |