C18H23N5O2 — CID 122334677
furan-3-yl-[4-(6-piperidin-1-ylpyridazin-3-yl)piperazin-1-yl]methanone (PubChem CID 122334677) has the molecular formula C18H23N5O2 and a molecular weight of 341.41 g/mol. Its IUPAC name is furan-3-yl-[4-(6-piperidin-1-ylpyridazin-3-yl)piperazin-1-yl]methanone.
| Compound Name | furan-3-yl-[4-(6-piperidin-1-ylpyridazin-3-yl)piperazin-1-yl]methanone |
|---|---|
| PubChem CID | 122334677 |
| Molecular Formula | C18H23N5O2 |
| Molecular Weight | 341.41 g/mol |
| Exact Mass | 341.19 |
| IUPAC Name | furan-3-yl-[4-(6-piperidin-1-ylpyridazin-3-yl)piperazin-1-yl]methanone |
| SMILES | O=C(c1ccoc1)N1CCN(c2ccc(N3CCCCC3)nn2)CC1 |
| InChI | InChI=1S/C18H23N5O2/c24-18(15-6-13-25-14-15)23-11-9-22(10-12-23)17-5-4-16(19-20-17)21-7-2-1-3-8-21/h4-6,13-14H,1-3,7-12H2 |
| InChIKey | AODVDXSVTOVPFC-UHFFFAOYSA-N |
| XLogP | 2.02 |
| TPSA | 65.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.41 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |