C22H31N5O2S — CID 122335072
1-[6-[4-[(3-methylphenyl)methylsulfonyl]piperazin-1-yl]pyridazin-3-yl]azepane (PubChem CID 122335072) has the molecular formula C22H31N5O2S and a molecular weight of 429.59 g/mol. Its IUPAC name is 1-[6-[4-[(3-methylphenyl)methylsulfonyl]piperazin-1-yl]pyridazin-3-yl]azepane.
| Compound Name | 1-[6-[4-[(3-methylphenyl)methylsulfonyl]piperazin-1-yl]pyridazin-3-yl]azepane |
|---|---|
| PubChem CID | 122335072 |
| Molecular Formula | C22H31N5O2S |
| Molecular Weight | 429.59 g/mol |
| Exact Mass | 429.22 |
| IUPAC Name | 1-[6-[4-[(3-methylphenyl)methylsulfonyl]piperazin-1-yl]pyridazin-3-yl]azepane |
| SMILES | Cc1cccc(CS(=O)(=O)N2CCN(c3ccc(N4CCCCCC4)nn3)CC2)c1 |
| InChI | InChI=1S/C22H31N5O2S/c1-19-7-6-8-20(17-19)18-30(28,29)27-15-13-26(14-16-27)22-10-9-21(23-24-22)25-11-4-2-3-5-12-25/h6-10,17H,2-5,11-16,18H2,1H3 |
| InChIKey | IHNMIQSRKNTJGQ-UHFFFAOYSA-N |
| XLogP | 2.82 |
| TPSA | 69.64 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.59 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |