C23H32N6O3S — CID 122335096
N-[4-[4-[6-(azepan-1-yl)pyridazin-3-yl]piperazin-1-yl]sulfonyl-3-methylphenyl]acetamide (PubChem CID 122335096) has the molecular formula C23H32N6O3S and a molecular weight of 472.62 g/mol. Its IUPAC name is N-[4-[4-[6-(azepan-1-yl)pyridazin-3-yl]piperazin-1-yl]sulfonyl-3-methylphenyl]acetamide.
| Compound Name | N-[4-[4-[6-(azepan-1-yl)pyridazin-3-yl]piperazin-1-yl]sulfonyl-3-methylphenyl]acetamide |
|---|---|
| PubChem CID | 122335096 |
| Molecular Formula | C23H32N6O3S |
| Molecular Weight | 472.62 g/mol |
| Exact Mass | 472.23 |
| IUPAC Name | N-[4-[4-[6-(azepan-1-yl)pyridazin-3-yl]piperazin-1-yl]sulfonyl-3-methylphenyl]acetamide |
| SMILES | CC(=O)Nc1ccc(S(=O)(=O)N2CCN(c3ccc(N4CCCCCC4)nn3)CC2)c(C)c1 |
| InChI | InChI=1S/C23H32N6O3S/c1-18-17-20(24-19(2)30)7-8-21(18)33(31,32)29-15-13-28(14-16-29)23-10-9-22(25-26-23)27-11-5-3-4-6-12-27/h7-10,17H,3-6,11-16H2,1-2H3,(H,24,30) |
| InChIKey | HFNKJGIJFULYNA-UHFFFAOYSA-N |
| XLogP | 2.63 |
| TPSA | 98.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.62 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |