C23H27N7O — CID 122335889
[4-[6-(2-methylpiperidin-1-yl)pyridazin-3-yl]piperazin-1-yl]-quinoxalin-6-ylmethanone (PubChem CID 122335889) has the molecular formula C23H27N7O and a molecular weight of 417.52 g/mol. Its IUPAC name is [4-[6-(2-methylpiperidin-1-yl)pyridazin-3-yl]piperazin-1-yl]-quinoxalin-6-ylmethanone.
| Compound Name | [4-[6-(2-methylpiperidin-1-yl)pyridazin-3-yl]piperazin-1-yl]-quinoxalin-6-ylmethanone |
|---|---|
| PubChem CID | 122335889 |
| Molecular Formula | C23H27N7O |
| Molecular Weight | 417.52 g/mol |
| Exact Mass | 417.23 |
| IUPAC Name | [4-[6-(2-methylpiperidin-1-yl)pyridazin-3-yl]piperazin-1-yl]-quinoxalin-6-ylmethanone |
| SMILES | CC1CCCCN1c1ccc(N2CCN(C(=O)c3ccc4nccnc4c3)CC2)nn1 |
| InChI | InChI=1S/C23H27N7O/c1-17-4-2-3-11-30(17)22-8-7-21(26-27-22)28-12-14-29(15-13-28)23(31)18-5-6-19-20(16-18)25-10-9-24-19/h5-10,16-17H,2-4,11-15H2,1H3 |
| InChIKey | PZXXGPJFJWFAPP-UHFFFAOYSA-N |
| XLogP | 2.76 |
| TPSA | 78.35 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.52 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |