C22H28FN5O — CID 122336125
2-(2-fluorophenyl)-1-[4-[6-(4-methylpiperidin-1-yl)pyridazin-3-yl]piperazin-1-yl]ethanone (PubChem CID 122336125) has the molecular formula C22H28FN5O and a molecular weight of 397.50 g/mol. Its IUPAC name is 2-(2-fluorophenyl)-1-[4-[6-(4-methylpiperidin-1-yl)pyridazin-3-yl]piperazin-1-yl]ethanone.
| Compound Name | 2-(2-fluorophenyl)-1-[4-[6-(4-methylpiperidin-1-yl)pyridazin-3-yl]piperazin-1-yl]ethanone |
|---|---|
| PubChem CID | 122336125 |
| Molecular Formula | C22H28FN5O |
| Molecular Weight | 397.50 g/mol |
| Exact Mass | 397.23 |
| IUPAC Name | 2-(2-fluorophenyl)-1-[4-[6-(4-methylpiperidin-1-yl)pyridazin-3-yl]piperazin-1-yl]ethanone |
| SMILES | CC1CCN(c2ccc(N3CCN(C(=O)Cc4ccccc4F)CC3)nn2)CC1 |
| InChI | InChI=1S/C22H28FN5O/c1-17-8-10-26(11-9-17)20-6-7-21(25-24-20)27-12-14-28(15-13-27)22(29)16-18-4-2-3-5-19(18)23/h2-7,17H,8-16H2,1H3 |
| InChIKey | MLZPXFXOYOYQNC-UHFFFAOYSA-N |
| XLogP | 2.74 |
| TPSA | 52.57 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.50 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |