C20H23N7O — CID 122337249
[3-(dimethylamino)phenyl]-[4-(6-pyrazol-1-ylpyrimidin-4-yl)piperazin-1-yl]methanone (PubChem CID 122337249) has the molecular formula C20H23N7O and a molecular weight of 377.45 g/mol. Its IUPAC name is [3-(dimethylamino)phenyl]-[4-(6-pyrazol-1-ylpyrimidin-4-yl)piperazin-1-yl]methanone.
| Compound Name | [3-(dimethylamino)phenyl]-[4-(6-pyrazol-1-ylpyrimidin-4-yl)piperazin-1-yl]methanone |
|---|---|
| PubChem CID | 122337249 |
| Molecular Formula | C20H23N7O |
| Molecular Weight | 377.45 g/mol |
| Exact Mass | 377.20 |
| IUPAC Name | [3-(dimethylamino)phenyl]-[4-(6-pyrazol-1-ylpyrimidin-4-yl)piperazin-1-yl]methanone |
| SMILES | CN(C)c1cccc(C(=O)N2CCN(c3cc(-n4cccn4)ncn3)CC2)c1 |
| InChI | InChI=1S/C20H23N7O/c1-24(2)17-6-3-5-16(13-17)20(28)26-11-9-25(10-12-26)18-14-19(22-15-21-18)27-8-4-7-23-27/h3-8,13-15H,9-12H2,1-2H3 |
| InChIKey | LEMQWENMZIDPPL-UHFFFAOYSA-N |
| XLogP | 1.69 |
| TPSA | 70.39 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.45 |
| LogP ≤ 5 | 1.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |