C26H34N6O2 — CID 122338042
[4-[6-(3,5-dimethylpyrazol-1-yl)-2-methylpyrimidin-4-yl]piperazin-1-yl]-(4-pentoxyphenyl)methanone (PubChem CID 122338042) has the molecular formula C26H34N6O2 and a molecular weight of 462.60 g/mol. Its IUPAC name is [4-[6-(3,5-dimethylpyrazol-1-yl)-2-methylpyrimidin-4-yl]piperazin-1-yl]-(4-pentoxyphenyl)methanone.
| Compound Name | [4-[6-(3,5-dimethylpyrazol-1-yl)-2-methylpyrimidin-4-yl]piperazin-1-yl]-(4-pentoxyphenyl)methanone |
|---|---|
| PubChem CID | 122338042 |
| Molecular Formula | C26H34N6O2 |
| Molecular Weight | 462.60 g/mol |
| Exact Mass | 462.27 |
| IUPAC Name | [4-[6-(3,5-dimethylpyrazol-1-yl)-2-methylpyrimidin-4-yl]piperazin-1-yl]-(4-pentoxyphenyl)methanone |
| SMILES | CCCCCOc1ccc(C(=O)N2CCN(c3cc(-n4nc(C)cc4C)nc(C)n3)CC2)cc1 |
| InChI | InChI=1S/C26H34N6O2/c1-5-6-7-16-34-23-10-8-22(9-11-23)26(33)31-14-12-30(13-15-31)24-18-25(28-21(4)27-24)32-20(3)17-19(2)29-32/h8-11,17-18H,5-7,12-16H2,1-4H3 |
| InChIKey | QYJIBCYAJYJART-UHFFFAOYSA-N |
| XLogP | 4.12 |
| TPSA | 76.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.60 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|