C24H26ClN5O — CID 122341570
[1-(4-chlorophenyl)cyclopentyl]-[4-(6-pyrrol-1-ylpyridazin-3-yl)piperazin-1-yl]methanone (PubChem CID 122341570) has the molecular formula C24H26ClN5O and a molecular weight of 435.96 g/mol. Its IUPAC name is [1-(4-chlorophenyl)cyclopentyl]-[4-(6-pyrrol-1-ylpyridazin-3-yl)piperazin-1-yl]methanone.
| Compound Name | [1-(4-chlorophenyl)cyclopentyl]-[4-(6-pyrrol-1-ylpyridazin-3-yl)piperazin-1-yl]methanone |
|---|---|
| PubChem CID | 122341570 |
| Molecular Formula | C24H26ClN5O |
| Molecular Weight | 435.96 g/mol |
| Exact Mass | 435.18 |
| IUPAC Name | [1-(4-chlorophenyl)cyclopentyl]-[4-(6-pyrrol-1-ylpyridazin-3-yl)piperazin-1-yl]methanone |
| SMILES | O=C(N1CCN(c2ccc(-n3cccc3)nn2)CC1)C1(c2ccc(Cl)cc2)CCCC1 |
| InChI | InChI=1S/C24H26ClN5O/c25-20-7-5-19(6-8-20)24(11-1-2-12-24)23(31)30-17-15-29(16-18-30)22-10-9-21(26-27-22)28-13-3-4-14-28/h3-10,13-14H,1-2,11-12,15-18H2 |
| InChIKey | QKJFWXPAFQUWFK-UHFFFAOYSA-N |
| XLogP | 4.08 |
| TPSA | 54.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.96 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |