C19H18ClFN6O — CID 122341881
N-(3-chloro-4-fluorophenyl)-4-(6-pyrrol-1-ylpyrimidin-4-yl)piperazine-1-carboxamide (PubChem CID 122341881) has the molecular formula C19H18ClFN6O and a molecular weight of 400.85 g/mol. Its IUPAC name is N-(3-chloro-4-fluorophenyl)-4-(6-pyrrol-1-ylpyrimidin-4-yl)piperazine-1-carboxamide.
| Compound Name | N-(3-chloro-4-fluorophenyl)-4-(6-pyrrol-1-ylpyrimidin-4-yl)piperazine-1-carboxamide |
|---|---|
| PubChem CID | 122341881 |
| Molecular Formula | C19H18ClFN6O |
| Molecular Weight | 400.85 g/mol |
| Exact Mass | 400.12 |
| IUPAC Name | N-(3-chloro-4-fluorophenyl)-4-(6-pyrrol-1-ylpyrimidin-4-yl)piperazine-1-carboxamide |
| SMILES | O=C(Nc1ccc(F)c(Cl)c1)N1CCN(c2cc(-n3cccc3)ncn2)CC1 |
| InChI | InChI=1S/C19H18ClFN6O/c20-15-11-14(3-4-16(15)21)24-19(28)27-9-7-26(8-10-27)18-12-17(22-13-23-18)25-5-1-2-6-25/h1-6,11-13H,7-10H2,(H,24,28) |
| InChIKey | LUPXMEOQOVMQLC-UHFFFAOYSA-N |
| XLogP | 3.41 |
| TPSA | 66.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.85 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |