C22H25N5O — CID 122342034
3-(3-methylphenyl)-1-[4-(6-pyrrol-1-ylpyrimidin-4-yl)piperazin-1-yl]propan-1-one (PubChem CID 122342034) has the molecular formula C22H25N5O and a molecular weight of 375.48 g/mol. Its IUPAC name is 3-(3-methylphenyl)-1-[4-(6-pyrrol-1-ylpyrimidin-4-yl)piperazin-1-yl]propan-1-one.
| Compound Name | 3-(3-methylphenyl)-1-[4-(6-pyrrol-1-ylpyrimidin-4-yl)piperazin-1-yl]propan-1-one |
|---|---|
| PubChem CID | 122342034 |
| Molecular Formula | C22H25N5O |
| Molecular Weight | 375.48 g/mol |
| Exact Mass | 375.21 |
| IUPAC Name | 3-(3-methylphenyl)-1-[4-(6-pyrrol-1-ylpyrimidin-4-yl)piperazin-1-yl]propan-1-one |
| SMILES | Cc1cccc(CCC(=O)N2CCN(c3cc(-n4cccc4)ncn3)CC2)c1 |
| InChI | InChI=1S/C22H25N5O/c1-18-5-4-6-19(15-18)7-8-22(28)27-13-11-26(12-14-27)21-16-20(23-17-24-21)25-9-2-3-10-25/h2-6,9-10,15-17H,7-8,11-14H2,1H3 |
| InChIKey | YZAFWAVDQAUKEA-UHFFFAOYSA-N |
| XLogP | 2.86 |
| TPSA | 54.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.48 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |