C20H26N6O2 — CID 122343113
(6-methoxy-3-pyridinyl)-[4-(6-piperidin-1-ylpyrimidin-4-yl)piperazin-1-yl]methanone (PubChem CID 122343113) has the molecular formula C20H26N6O2 and a molecular weight of 382.47 g/mol. Its IUPAC name is (6-methoxy-3-pyridinyl)-[4-(6-piperidin-1-ylpyrimidin-4-yl)piperazin-1-yl]methanone.
| Compound Name | (6-methoxy-3-pyridinyl)-[4-(6-piperidin-1-ylpyrimidin-4-yl)piperazin-1-yl]methanone |
|---|---|
| PubChem CID | 122343113 |
| Molecular Formula | C20H26N6O2 |
| Molecular Weight | 382.47 g/mol |
| Exact Mass | 382.21 |
| IUPAC Name | (6-methoxy-3-pyridinyl)-[4-(6-piperidin-1-ylpyrimidin-4-yl)piperazin-1-yl]methanone |
| SMILES | COc1ccc(C(=O)N2CCN(c3cc(N4CCCCC4)ncn3)CC2)cn1 |
| InChI | InChI=1S/C20H26N6O2/c1-28-19-6-5-16(14-21-19)20(27)26-11-9-25(10-12-26)18-13-17(22-15-23-18)24-7-3-2-4-8-24/h5-6,13-15H,2-4,7-12H2,1H3 |
| InChIKey | VFPBMUYGSRLOBG-UHFFFAOYSA-N |
| XLogP | 1.83 |
| TPSA | 74.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.47 |
| LogP ≤ 5 | 1.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |