C21H20N6OS — CID 122344823
1-benzothiophen-2-yl-[4-[6-(3-methylpyrazol-1-yl)pyrimidin-4-yl]piperazin-1-yl]methanone (PubChem CID 122344823) has the molecular formula C21H20N6OS and a molecular weight of 404.50 g/mol. Its IUPAC name is 1-benzothiophen-2-yl-[4-[6-(3-methylpyrazol-1-yl)pyrimidin-4-yl]piperazin-1-yl]methanone.
| Compound Name | 1-benzothiophen-2-yl-[4-[6-(3-methylpyrazol-1-yl)pyrimidin-4-yl]piperazin-1-yl]methanone |
|---|---|
| PubChem CID | 122344823 |
| Molecular Formula | C21H20N6OS |
| Molecular Weight | 404.50 g/mol |
| Exact Mass | 404.14 |
| IUPAC Name | 1-benzothiophen-2-yl-[4-[6-(3-methylpyrazol-1-yl)pyrimidin-4-yl]piperazin-1-yl]methanone |
| SMILES | Cc1ccn(-c2cc(N3CCN(C(=O)c4cc5ccccc5s4)CC3)ncn2)n1 |
| InChI | InChI=1S/C21H20N6OS/c1-15-6-7-27(24-15)20-13-19(22-14-23-20)25-8-10-26(11-9-25)21(28)18-12-16-4-2-3-5-17(16)29-18/h2-7,12-14H,8-11H2,1H3 |
| InChIKey | WYZKJPJTZMDEQE-UHFFFAOYSA-N |
| XLogP | 3.15 |
| TPSA | 67.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.50 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |