C24H32N6O3S — CID 122345029
4-[4-(4-butoxyphenyl)sulfonylpiperazin-1-yl]-6-(4,5-dimethylimidazol-1-yl)-2-methylpyrimidine (PubChem CID 122345029) has the molecular formula C24H32N6O3S and a molecular weight of 484.63 g/mol. Its IUPAC name is 4-[4-(4-butoxyphenyl)sulfonylpiperazin-1-yl]-6-(4,5-dimethylimidazol-1-yl)-2-methylpyrimidine.
| Compound Name | 4-[4-(4-butoxyphenyl)sulfonylpiperazin-1-yl]-6-(4,5-dimethylimidazol-1-yl)-2-methylpyrimidine |
|---|---|
| PubChem CID | 122345029 |
| Molecular Formula | C24H32N6O3S |
| Molecular Weight | 484.63 g/mol |
| Exact Mass | 484.23 |
| IUPAC Name | 4-[4-(4-butoxyphenyl)sulfonylpiperazin-1-yl]-6-(4,5-dimethylimidazol-1-yl)-2-methylpyrimidine |
| SMILES | CCCCOc1ccc(S(=O)(=O)N2CCN(c3cc(-n4cnc(C)c4C)nc(C)n3)CC2)cc1 |
| InChI | InChI=1S/C24H32N6O3S/c1-5-6-15-33-21-7-9-22(10-8-21)34(31,32)29-13-11-28(12-14-29)23-16-24(27-20(4)26-23)30-17-25-18(2)19(30)3/h7-10,16-17H,5-6,11-15H2,1-4H3 |
| InChIKey | JRFCMCQBYGMOBX-UHFFFAOYSA-N |
| XLogP | 3.28 |
| TPSA | 93.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.63 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|