C20H21ClN6O — CID 122345835
2-(2-chlorophenyl)-1-[4-[6-(3-methylpyrazol-1-yl)pyridazin-3-yl]piperazin-1-yl]ethanone (PubChem CID 122345835) has the molecular formula C20H21ClN6O and a molecular weight of 396.88 g/mol. Its IUPAC name is 2-(2-chlorophenyl)-1-[4-[6-(3-methylpyrazol-1-yl)pyridazin-3-yl]piperazin-1-yl]ethanone.
| Compound Name | 2-(2-chlorophenyl)-1-[4-[6-(3-methylpyrazol-1-yl)pyridazin-3-yl]piperazin-1-yl]ethanone |
|---|---|
| PubChem CID | 122345835 |
| Molecular Formula | C20H21ClN6O |
| Molecular Weight | 396.88 g/mol |
| Exact Mass | 396.15 |
| IUPAC Name | 2-(2-chlorophenyl)-1-[4-[6-(3-methylpyrazol-1-yl)pyridazin-3-yl]piperazin-1-yl]ethanone |
| SMILES | Cc1ccn(-c2ccc(N3CCN(C(=O)Cc4ccccc4Cl)CC3)nn2)n1 |
| InChI | InChI=1S/C20H21ClN6O/c1-15-8-9-27(24-15)19-7-6-18(22-23-19)25-10-12-26(13-11-25)20(28)14-16-4-2-3-5-17(16)21/h2-9H,10-14H2,1H3 |
| InChIKey | OAHUHWYSUXSUBN-UHFFFAOYSA-N |
| XLogP | 2.52 |
| TPSA | 67.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.88 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |