C20H19N7O — CID 122345898
3-[4-[6-(3-methylpyrazol-1-yl)pyridazin-3-yl]piperazine-1-carbonyl]benzonitrile (PubChem CID 122345898) has the molecular formula C20H19N7O and a molecular weight of 373.42 g/mol. Its IUPAC name is 3-[4-[6-(3-methylpyrazol-1-yl)pyridazin-3-yl]piperazine-1-carbonyl]benzonitrile.
| Compound Name | 3-[4-[6-(3-methylpyrazol-1-yl)pyridazin-3-yl]piperazine-1-carbonyl]benzonitrile |
|---|---|
| PubChem CID | 122345898 |
| Molecular Formula | C20H19N7O |
| Molecular Weight | 373.42 g/mol |
| Exact Mass | 373.17 |
| IUPAC Name | 3-[4-[6-(3-methylpyrazol-1-yl)pyridazin-3-yl]piperazine-1-carbonyl]benzonitrile |
| SMILES | Cc1ccn(-c2ccc(N3CCN(C(=O)c4cccc(C#N)c4)CC3)nn2)n1 |
| InChI | InChI=1S/C20H19N7O/c1-15-7-8-27(24-15)19-6-5-18(22-23-19)25-9-11-26(12-10-25)20(28)17-4-2-3-16(13-17)14-21/h2-8,13H,9-12H2,1H3 |
| InChIKey | WHHAXEWPVSSGEV-UHFFFAOYSA-N |
| XLogP | 1.80 |
| TPSA | 90.94 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.42 |
| LogP ≤ 5 | 1.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |