C20H24N6O3S — CID 122346034
3-(3-methylpyrazol-1-yl)-6-[4-(2-phenoxyethylsulfonyl)piperazin-1-yl]pyridazine (PubChem CID 122346034) has the molecular formula C20H24N6O3S and a molecular weight of 428.52 g/mol. Its IUPAC name is 3-(3-methylpyrazol-1-yl)-6-[4-(2-phenoxyethylsulfonyl)piperazin-1-yl]pyridazine.
| Compound Name | 3-(3-methylpyrazol-1-yl)-6-[4-(2-phenoxyethylsulfonyl)piperazin-1-yl]pyridazine |
|---|---|
| PubChem CID | 122346034 |
| Molecular Formula | C20H24N6O3S |
| Molecular Weight | 428.52 g/mol |
| Exact Mass | 428.16 |
| IUPAC Name | 3-(3-methylpyrazol-1-yl)-6-[4-(2-phenoxyethylsulfonyl)piperazin-1-yl]pyridazine |
| SMILES | Cc1ccn(-c2ccc(N3CCN(S(=O)(=O)CCOc4ccccc4)CC3)nn2)n1 |
| InChI | InChI=1S/C20H24N6O3S/c1-17-9-10-26(23-17)20-8-7-19(21-22-20)24-11-13-25(14-12-24)30(27,28)16-15-29-18-5-3-2-4-6-18/h2-10H,11-16H2,1H3 |
| InChIKey | KMJSGGUEPGWEGL-UHFFFAOYSA-N |
| XLogP | 1.50 |
| TPSA | 93.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.52 |
| LogP ≤ 5 | 1.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |