C26H28N6O — CID 122348765
2-indol-1-yl-1-[4-[2-methyl-6-(4-methylanilino)pyrimidin-4-yl]piperazin-1-yl]ethanone (PubChem CID 122348765) has the molecular formula C26H28N6O and a molecular weight of 440.55 g/mol. Its IUPAC name is 2-indol-1-yl-1-[4-[2-methyl-6-(4-methylanilino)pyrimidin-4-yl]piperazin-1-yl]ethanone.
| Compound Name | 2-indol-1-yl-1-[4-[2-methyl-6-(4-methylanilino)pyrimidin-4-yl]piperazin-1-yl]ethanone |
|---|---|
| PubChem CID | 122348765 |
| Molecular Formula | C26H28N6O |
| Molecular Weight | 440.55 g/mol |
| Exact Mass | 440.23 |
| IUPAC Name | 2-indol-1-yl-1-[4-[2-methyl-6-(4-methylanilino)pyrimidin-4-yl]piperazin-1-yl]ethanone |
| SMILES | Cc1ccc(Nc2cc(N3CCN(C(=O)Cn4ccc5ccccc54)CC3)nc(C)n2)cc1 |
| InChI | InChI=1S/C26H28N6O/c1-19-7-9-22(10-8-19)29-24-17-25(28-20(2)27-24)30-13-15-31(16-14-30)26(33)18-32-12-11-21-5-3-4-6-23(21)32/h3-12,17H,13-16,18H2,1-2H3,(H,27,28,29) |
| InChIKey | ABSKMGVAGKGKDB-UHFFFAOYSA-N |
| XLogP | 4.14 |
| TPSA | 66.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.55 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |