C18H23FN4O2S — CID 122352951
1-(4-fluorophenyl)-N-[(6-methyl-2-piperidin-1-ylpyrimidin-4-yl)methyl]methanesulfonamide (PubChem CID 122352951) has the molecular formula C18H23FN4O2S and a molecular weight of 378.47 g/mol. Its IUPAC name is 1-(4-fluorophenyl)-N-[(6-methyl-2-piperidin-1-ylpyrimidin-4-yl)methyl]methanesulfonamide.
| Compound Name | 1-(4-fluorophenyl)-N-[(6-methyl-2-piperidin-1-ylpyrimidin-4-yl)methyl]methanesulfonamide |
|---|---|
| PubChem CID | 122352951 |
| Molecular Formula | C18H23FN4O2S |
| Molecular Weight | 378.47 g/mol |
| Exact Mass | 378.15 |
| IUPAC Name | 1-(4-fluorophenyl)-N-[(6-methyl-2-piperidin-1-ylpyrimidin-4-yl)methyl]methanesulfonamide |
| SMILES | Cc1cc(CNS(=O)(=O)Cc2ccc(F)cc2)nc(N2CCCCC2)n1 |
| InChI | InChI=1S/C18H23FN4O2S/c1-14-11-17(22-18(21-14)23-9-3-2-4-10-23)12-20-26(24,25)13-15-5-7-16(19)8-6-15/h5-8,11,20H,2-4,9-10,12-13H2,1H3 |
| InChIKey | CXKHNGHRYWXWBD-UHFFFAOYSA-N |
| XLogP | 2.53 |
| TPSA | 75.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.47 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |