C14H19N7O2 — CID 122353728
1-methyl-N-[(6-methyl-2-morpholin-4-ylpyrimidin-4-yl)methyl]triazole-4-carboxamide (PubChem CID 122353728) has the molecular formula C14H19N7O2 and a molecular weight of 317.35 g/mol. Its IUPAC name is 1-methyl-N-[(6-methyl-2-morpholin-4-ylpyrimidin-4-yl)methyl]triazole-4-carboxamide.
| Compound Name | 1-methyl-N-[(6-methyl-2-morpholin-4-ylpyrimidin-4-yl)methyl]triazole-4-carboxamide |
|---|---|
| PubChem CID | 122353728 |
| Molecular Formula | C14H19N7O2 |
| Molecular Weight | 317.35 g/mol |
| Exact Mass | 317.16 |
| IUPAC Name | 1-methyl-N-[(6-methyl-2-morpholin-4-ylpyrimidin-4-yl)methyl]triazole-4-carboxamide |
| SMILES | Cc1cc(CNC(=O)c2cn(C)nn2)nc(N2CCOCC2)n1 |
| InChI | InChI=1S/C14H19N7O2/c1-10-7-11(8-15-13(22)12-9-20(2)19-18-12)17-14(16-10)21-3-5-23-6-4-21/h7,9H,3-6,8H2,1-2H3,(H,15,22) |
| InChIKey | STCSMLXNPNDIBV-UHFFFAOYSA-N |
| XLogP | -0.32 |
| TPSA | 98.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.35 |
| LogP ≤ 5 | -0.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |