C13H20N6O2S — CID 122354460
N-[[2-(dimethylamino)pyrimidin-4-yl]methyl]-1-ethyl-2-methylimidazole-4-sulfonamide (PubChem CID 122354460) has the molecular formula C13H20N6O2S and a molecular weight of 324.41 g/mol. Its IUPAC name is N-[[2-(dimethylamino)pyrimidin-4-yl]methyl]-1-ethyl-2-methylimidazole-4-sulfonamide.
| Compound Name | N-[[2-(dimethylamino)pyrimidin-4-yl]methyl]-1-ethyl-2-methylimidazole-4-sulfonamide |
|---|---|
| PubChem CID | 122354460 |
| Molecular Formula | C13H20N6O2S |
| Molecular Weight | 324.41 g/mol |
| Exact Mass | 324.14 |
| IUPAC Name | N-[[2-(dimethylamino)pyrimidin-4-yl]methyl]-1-ethyl-2-methylimidazole-4-sulfonamide |
| SMILES | CCn1cc(S(=O)(=O)NCc2ccnc(N(C)C)n2)nc1C |
| InChI | InChI=1S/C13H20N6O2S/c1-5-19-9-12(16-10(19)2)22(20,21)15-8-11-6-7-14-13(17-11)18(3)4/h6-7,9,15H,5,8H2,1-4H3 |
| InChIKey | QXLYHRRSOZBYAW-UHFFFAOYSA-N |
| XLogP | 0.55 |
| TPSA | 93.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.41 |
| LogP ≤ 5 | 0.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |