C11H6ClF3N2O — CID 122358498
5-[4-chloro-3-(trifluoromethyl)phenyl]-1H-pyrimidin-6-one (PubChem CID 122358498) has the molecular formula C11H6ClF3N2O and a molecular weight of 274.63 g/mol. Its IUPAC name is 5-[4-chloro-3-(trifluoromethyl)phenyl]-1H-pyrimidin-6-one.
| Compound Name | 5-[4-chloro-3-(trifluoromethyl)phenyl]-1H-pyrimidin-6-one |
|---|---|
| PubChem CID | 122358498 |
| Molecular Formula | C11H6ClF3N2O |
| Molecular Weight | 274.63 g/mol |
| Exact Mass | 274.01 |
| IUPAC Name | 5-[4-chloro-3-(trifluoromethyl)phenyl]-1H-pyrimidin-6-one |
| SMILES | O=c1[nH]cncc1-c1ccc(Cl)c(C(F)(F)F)c1 |
| InChI | InChI=1S/C11H6ClF3N2O/c12-9-2-1-6(3-8(9)11(13,14)15)7-4-16-5-17-10(7)18/h1-5H,(H,16,17,18) |
| InChIKey | INNRXBQZUCVHCX-UHFFFAOYSA-N |
| XLogP | 3.11 |
| TPSA | 45.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.63 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |