About 1-ethyl-2,6-dimethylpiperazine;dihydrochloride
1-ethyl-2,6-dimethylpiperazine;dihydrochloride (PubChem CID 122360216) has the molecular formula C8H20Cl2N2
and a molecular weight of 215.17 g/mol. Its IUPAC name is 1-ethyl-2,6-dimethylpiperazine;dihydrochloride.
Molecular Properties
| Compound Name | 1-ethyl-2,6-dimethylpiperazine;dihydrochloride |
| PubChem CID | 122360216 |
| Molecular Formula | C8H20Cl2N2 |
| Molecular Weight | 215.17 g/mol |
| Exact Mass | 214.10 |
| IUPAC Name | 1-ethyl-2,6-dimethylpiperazine;dihydrochloride |
| SMILES | CCN1C(C)CNCC1C.Cl.Cl |
| InChI | InChI=1S/C8H18N2.2ClH/c1-4-10-7(2)5-9-6-8(10)3;;/h7-9H,4-6H2,1-3H3;2*1H |
| InChIKey | CCIWPJNDTVTIKI-UHFFFAOYSA-N |
| XLogP | 1.53 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 215.17 |
| LogP ≤ 5 | 1.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 1-ethyl-2,6-dimethylpiperazine;dihydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-ethyl-2,6-dimethylpiperazine;dihydrochloride?
The IUPAC name of 1-ethyl-2,6-dimethylpiperazine;dihydrochloride (CID 122360216) is 1-ethyl-2,6-dimethylpiperazine;dihydrochloride.
What is the SMILES notation for 1-ethyl-2,6-dimethylpiperazine;dihydrochloride?
The canonical SMILES for 1-ethyl-2,6-dimethylpiperazine;dihydrochloride is CCN1C(C)CNCC1C.Cl.Cl.
What is the InChIKey of 1-ethyl-2,6-dimethylpiperazine;dihydrochloride?
The InChIKey is CCIWPJNDTVTIKI-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H18N2.2ClH/c1-4-10-7(2)5-9-6-8(10)3;;/h7-9H,4-6H2,1-3H3;2*1H.
What are the key properties of 1-ethyl-2,6-dimethylpiperazine;dihydrochloride?
1-ethyl-2,6-dimethylpiperazine;dihydrochloride has a molecular weight of 215.17 g/mol, XLogP of 1.53, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-ethyl-2,6-dimethylpiperazine;dihydrochloride is sourced from PubChem (CID 122360216), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).