C10H17FN4 — CID 122360339
[4-fluoro-1-[(1-methylpyrazol-4-yl)methyl]pyrrolidin-2-yl]methanamine (PubChem CID 122360339) has the molecular formula C10H17FN4 and a molecular weight of 212.27 g/mol. Its IUPAC name is [4-fluoro-1-[(1-methylpyrazol-4-yl)methyl]pyrrolidin-2-yl]methanamine.
| Compound Name | [4-fluoro-1-[(1-methylpyrazol-4-yl)methyl]pyrrolidin-2-yl]methanamine |
|---|---|
| PubChem CID | 122360339 |
| Molecular Formula | C10H17FN4 |
| Molecular Weight | 212.27 g/mol |
| Exact Mass | 212.14 |
| IUPAC Name | [4-fluoro-1-[(1-methylpyrazol-4-yl)methyl]pyrrolidin-2-yl]methanamine |
| SMILES | Cn1cc(CN2CC(F)CC2CN)cn1 |
| InChI | InChI=1S/C10H17FN4/c1-14-5-8(4-13-14)6-15-7-9(11)2-10(15)3-12/h4-5,9-10H,2-3,6-7,12H2,1H3 |
| InChIKey | UTCSLRWTGRCPOO-UHFFFAOYSA-N |
| XLogP | 0.29 |
| TPSA | 47.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 212.27 |
| LogP ≤ 5 | 0.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |