About 1-(1,4-diazepan-1-yl)-3-methylbutan-1-one;hydrochloride
1-(1,4-diazepan-1-yl)-3-methylbutan-1-one;hydrochloride (PubChem CID 122360519) has the molecular formula C10H21ClN2O
and a molecular weight of 220.74 g/mol. Its IUPAC name is 1-(1,4-diazepan-1-yl)-3-methylbutan-1-one;hydrochloride.
Molecular Properties
| Compound Name | 1-(1,4-diazepan-1-yl)-3-methylbutan-1-one;hydrochloride |
| PubChem CID | 122360519 |
| Molecular Formula | C10H21ClN2O |
| Molecular Weight | 220.74 g/mol |
| Exact Mass | 220.13 |
| IUPAC Name | 1-(1,4-diazepan-1-yl)-3-methylbutan-1-one;hydrochloride |
| SMILES | CC(C)CC(=O)N1CCCNCC1.Cl |
| InChI | InChI=1S/C10H20N2O.ClH/c1-9(2)8-10(13)12-6-3-4-11-5-7-12;/h9,11H,3-8H2,1-2H3;1H |
| InChIKey | DUCZTQGWFCMLLN-UHFFFAOYSA-N |
| XLogP | 1.28 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 220.74 |
| LogP ≤ 5 | 1.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 1-(1,4-diazepan-1-yl)-3-methylbutan-1-one;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(1,4-diazepan-1-yl)-3-methylbutan-1-one;hydrochloride?
The IUPAC name of 1-(1,4-diazepan-1-yl)-3-methylbutan-1-one;hydrochloride (CID 122360519) is 1-(1,4-diazepan-1-yl)-3-methylbutan-1-one;hydrochloride.
What is the SMILES notation for 1-(1,4-diazepan-1-yl)-3-methylbutan-1-one;hydrochloride?
The canonical SMILES for 1-(1,4-diazepan-1-yl)-3-methylbutan-1-one;hydrochloride is CC(C)CC(=O)N1CCCNCC1.Cl.
What is the InChIKey of 1-(1,4-diazepan-1-yl)-3-methylbutan-1-one;hydrochloride?
The InChIKey is DUCZTQGWFCMLLN-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H20N2O.ClH/c1-9(2)8-10(13)12-6-3-4-11-5-7-12;/h9,11H,3-8H2,1-2H3;1H.
What are the key properties of 1-(1,4-diazepan-1-yl)-3-methylbutan-1-one;hydrochloride?
1-(1,4-diazepan-1-yl)-3-methylbutan-1-one;hydrochloride has a molecular weight of 220.74 g/mol, XLogP of 1.28, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(1,4-diazepan-1-yl)-3-methylbutan-1-one;hydrochloride is sourced from PubChem (CID 122360519), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).