About 4-piperidin-4-yl-1,3-thiazole;dihydrochloride
4-piperidin-4-yl-1,3-thiazole;dihydrochloride (PubChem CID 122360523) has the molecular formula C8H14Cl2N2S
and a molecular weight of 241.19 g/mol. Its IUPAC name is 4-piperidin-4-yl-1,3-thiazole;dihydrochloride.
Molecular Properties
| Compound Name | 4-piperidin-4-yl-1,3-thiazole;dihydrochloride |
| PubChem CID | 122360523 |
| Molecular Formula | C8H14Cl2N2S |
| Molecular Weight | 241.19 g/mol |
| Exact Mass | 240.03 |
| IUPAC Name | 4-piperidin-4-yl-1,3-thiazole;dihydrochloride |
| SMILES | Cl.Cl.c1nc(C2CCNCC2)cs1 |
| InChI | InChI=1S/C8H12N2S.2ClH/c1-3-9-4-2-7(1)8-5-11-6-10-8;;/h5-7,9H,1-4H2;2*1H |
| InChIKey | OHUMDHUHZZDVPK-UHFFFAOYSA-N |
| XLogP | 2.45 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 241.19 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 4-piperidin-4-yl-1,3-thiazole;dihydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-piperidin-4-yl-1,3-thiazole;dihydrochloride?
The IUPAC name of 4-piperidin-4-yl-1,3-thiazole;dihydrochloride (CID 122360523) is 4-piperidin-4-yl-1,3-thiazole;dihydrochloride.
What is the SMILES notation for 4-piperidin-4-yl-1,3-thiazole;dihydrochloride?
The canonical SMILES for 4-piperidin-4-yl-1,3-thiazole;dihydrochloride is Cl.Cl.c1nc(C2CCNCC2)cs1.
What is the InChIKey of 4-piperidin-4-yl-1,3-thiazole;dihydrochloride?
The InChIKey is OHUMDHUHZZDVPK-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H12N2S.2ClH/c1-3-9-4-2-7(1)8-5-11-6-10-8;;/h5-7,9H,1-4H2;2*1H.
What are the key properties of 4-piperidin-4-yl-1,3-thiazole;dihydrochloride?
4-piperidin-4-yl-1,3-thiazole;dihydrochloride has a molecular weight of 241.19 g/mol, XLogP of 2.45, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-piperidin-4-yl-1,3-thiazole;dihydrochloride is sourced from PubChem (CID 122360523), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).