About [bis(2,5-dioxopyrrolidin-1-yl)-propanoyloxy-λ4-selanyl] propanoate
[bis(2,5-dioxopyrrolidin-1-yl)-propanoyloxy-λ4-selanyl] propanoate (PubChem CID 122360676) has the molecular formula C14H18N2O8Se
and a molecular weight of 421.26 g/mol. Its IUPAC name is [bis(2,5-dioxopyrrolidin-1-yl)-propanoyloxy-λ4-selanyl] propanoate.
Molecular Properties
| Compound Name | [bis(2,5-dioxopyrrolidin-1-yl)-propanoyloxy-λ4-selanyl] propanoate |
| PubChem CID | 122360676 |
| Molecular Formula | C14H18N2O8Se |
| Molecular Weight | 421.26 g/mol |
| Exact Mass | 422.02 |
| IUPAC Name | [bis(2,5-dioxopyrrolidin-1-yl)-propanoyloxy-λ4-selanyl] propanoate |
| SMILES | CCC(=O)O[Se](OC(=O)CC)(N1C(=O)CCC1=O)N1C(=O)CCC1=O |
| InChI | InChI=1S/C14H18N2O8Se/c1-3-13(21)23-25(24-14(22)4-2,15-9(17)5-6-10(15)18)16-11(19)7-8-12(16)20/h3-8H2,1-2H3 |
| InChIKey | GVWGCLONMAHVOL-UHFFFAOYSA-N |
| XLogP | -0.37 |
| TPSA | 127.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 421.26 |
| LogP ≤ 5 | -0.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|
Analyze [bis(2,5-dioxopyrrolidin-1-yl)-propanoyloxy-λ4-selanyl] propanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [bis(2,5-dioxopyrrolidin-1-yl)-propanoyloxy-λ4-selanyl] propanoate?
The IUPAC name of [bis(2,5-dioxopyrrolidin-1-yl)-propanoyloxy-λ4-selanyl] propanoate (CID 122360676) is [bis(2,5-dioxopyrrolidin-1-yl)-propanoyloxy-λ4-selanyl] propanoate.
What is the SMILES notation for [bis(2,5-dioxopyrrolidin-1-yl)-propanoyloxy-λ4-selanyl] propanoate?
The canonical SMILES for [bis(2,5-dioxopyrrolidin-1-yl)-propanoyloxy-λ4-selanyl] propanoate is CCC(=O)O[Se](OC(=O)CC)(N1C(=O)CCC1=O)N1C(=O)CCC1=O.
What is the InChIKey of [bis(2,5-dioxopyrrolidin-1-yl)-propanoyloxy-λ4-selanyl] propanoate?
The InChIKey is GVWGCLONMAHVOL-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H18N2O8Se/c1-3-13(21)23-25(24-14(22)4-2,15-9(17)5-6-10(15)18)16-11(19)7-8-12(16)20/h3-8H2,1-2H3.
What are the key properties of [bis(2,5-dioxopyrrolidin-1-yl)-propanoyloxy-λ4-selanyl] propanoate?
[bis(2,5-dioxopyrrolidin-1-yl)-propanoyloxy-λ4-selanyl] propanoate has a molecular weight of 421.26 g/mol, XLogP of -0.37, 6 rotatable bonds, 0 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for [bis(2,5-dioxopyrrolidin-1-yl)-propanoyloxy-λ4-selanyl] propanoate is sourced from PubChem (CID 122360676), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).