About 8-(trifluoromethoxy)-1H-3,1-benzoxazine-2,4-dione
8-(trifluoromethoxy)-1H-3,1-benzoxazine-2,4-dione (PubChem CID 122360697) has the molecular formula C9H4F3NO4
and a molecular weight of 247.13 g/mol. Its IUPAC name is 8-(trifluoromethoxy)-1H-3,1-benzoxazine-2,4-dione.
Molecular Properties
| Compound Name | 8-(trifluoromethoxy)-1H-3,1-benzoxazine-2,4-dione |
| PubChem CID | 122360697 |
| Molecular Formula | C9H4F3NO4 |
| Molecular Weight | 247.13 g/mol |
| Exact Mass | 247.01 |
| IUPAC Name | 8-(trifluoromethoxy)-1H-3,1-benzoxazine-2,4-dione |
| SMILES | O=c1[nH]c2c(OC(F)(F)F)cccc2c(=O)o1 |
| InChI | InChI=1S/C9H4F3NO4/c10-9(11,12)17-5-3-1-2-4-6(5)13-8(15)16-7(4)14/h1-3H,(H,13,15) |
| InChIKey | LBDLMPWJVUYEDU-UHFFFAOYSA-N |
| XLogP | 1.38 |
| TPSA | 72.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 247.13 |
| LogP ≤ 5 | 1.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 8-(trifluoromethoxy)-1H-3,1-benzoxazine-2,4-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 8-(trifluoromethoxy)-1H-3,1-benzoxazine-2,4-dione?
The IUPAC name of 8-(trifluoromethoxy)-1H-3,1-benzoxazine-2,4-dione (CID 122360697) is 8-(trifluoromethoxy)-1H-3,1-benzoxazine-2,4-dione.
What is the SMILES notation for 8-(trifluoromethoxy)-1H-3,1-benzoxazine-2,4-dione?
The canonical SMILES for 8-(trifluoromethoxy)-1H-3,1-benzoxazine-2,4-dione is O=c1[nH]c2c(OC(F)(F)F)cccc2c(=O)o1.
What is the InChIKey of 8-(trifluoromethoxy)-1H-3,1-benzoxazine-2,4-dione?
The InChIKey is LBDLMPWJVUYEDU-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H4F3NO4/c10-9(11,12)17-5-3-1-2-4-6(5)13-8(15)16-7(4)14/h1-3H,(H,13,15).
What are the key properties of 8-(trifluoromethoxy)-1H-3,1-benzoxazine-2,4-dione?
8-(trifluoromethoxy)-1H-3,1-benzoxazine-2,4-dione has a molecular weight of 247.13 g/mol, XLogP of 1.38, 1 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 8-(trifluoromethoxy)-1H-3,1-benzoxazine-2,4-dione is sourced from PubChem (CID 122360697), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).