About 3,5-bis(pentafluoro-λ6-sulfanyl)benzoic acid
3,5-bis(pentafluoro-λ6-sulfanyl)benzoic acid (PubChem CID 122360931) has the molecular formula C7H4F10O2S2
and a molecular weight of 374.22 g/mol. Its IUPAC name is 3,5-bis(pentafluoro-λ6-sulfanyl)benzoic acid.
Molecular Properties
| Compound Name | 3,5-bis(pentafluoro-λ6-sulfanyl)benzoic acid |
| PubChem CID | 122360931 |
| Molecular Formula | C7H4F10O2S2 |
| Molecular Weight | 374.22 g/mol |
| Exact Mass | 373.95 |
| IUPAC Name | 3,5-bis(pentafluoro-λ6-sulfanyl)benzoic acid |
| SMILES | O=C(O)c1cc(S(F)(F)(F)(F)F)cc(S(F)(F)(F)(F)F)c1 |
| InChI | InChI=1S/C7H4F10O2S2/c8-20(9,10,11,12)5-1-4(7(18)19)2-6(3-5)21(13,14,15,16)17/h1-3H,(H,18,19) |
| InChIKey | UFXDTBJHHNNRML-UHFFFAOYSA-N |
| XLogP | 6.70 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 374.22 |
| LogP ≤ 5 | 6.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 3,5-bis(pentafluoro-λ6-sulfanyl)benzoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3,5-bis(pentafluoro-λ6-sulfanyl)benzoic acid?
The IUPAC name of 3,5-bis(pentafluoro-λ6-sulfanyl)benzoic acid (CID 122360931) is 3,5-bis(pentafluoro-λ6-sulfanyl)benzoic acid.
What is the SMILES notation for 3,5-bis(pentafluoro-λ6-sulfanyl)benzoic acid?
The canonical SMILES for 3,5-bis(pentafluoro-λ6-sulfanyl)benzoic acid is O=C(O)c1cc(S(F)(F)(F)(F)F)cc(S(F)(F)(F)(F)F)c1.
What is the InChIKey of 3,5-bis(pentafluoro-λ6-sulfanyl)benzoic acid?
The InChIKey is UFXDTBJHHNNRML-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H4F10O2S2/c8-20(9,10,11,12)5-1-4(7(18)19)2-6(3-5)21(13,14,15,16)17/h1-3H,(H,18,19).
What are the key properties of 3,5-bis(pentafluoro-λ6-sulfanyl)benzoic acid?
3,5-bis(pentafluoro-λ6-sulfanyl)benzoic acid has a molecular weight of 374.22 g/mol, XLogP of 6.70, 3 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 3,5-bis(pentafluoro-λ6-sulfanyl)benzoic acid is sourced from PubChem (CID 122360931), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).