About 2-(bromomethyl)-1-ethoxy-3,4,5-trifluorobenzene
2-(bromomethyl)-1-ethoxy-3,4,5-trifluorobenzene (PubChem CID 122361199) has the molecular formula C9H8BrF3O
and a molecular weight of 269.06 g/mol. Its IUPAC name is 2-(bromomethyl)-1-ethoxy-3,4,5-trifluorobenzene.
Molecular Properties
| Compound Name | 2-(bromomethyl)-1-ethoxy-3,4,5-trifluorobenzene |
| PubChem CID | 122361199 |
| Molecular Formula | C9H8BrF3O |
| Molecular Weight | 269.06 g/mol |
| Exact Mass | 267.97 |
| IUPAC Name | 2-(bromomethyl)-1-ethoxy-3,4,5-trifluorobenzene |
| SMILES | CCOc1cc(F)c(F)c(F)c1CBr |
| InChI | InChI=1S/C9H8BrF3O/c1-2-14-7-3-6(11)9(13)8(12)5(7)4-10/h3H,2,4H2,1H3 |
| InChIKey | XJFNNXQODYHRHG-UHFFFAOYSA-N |
| XLogP | 3.40 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 269.06 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|
Analyze 2-(bromomethyl)-1-ethoxy-3,4,5-trifluorobenzene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(bromomethyl)-1-ethoxy-3,4,5-trifluorobenzene?
The IUPAC name of 2-(bromomethyl)-1-ethoxy-3,4,5-trifluorobenzene (CID 122361199) is 2-(bromomethyl)-1-ethoxy-3,4,5-trifluorobenzene.
What is the SMILES notation for 2-(bromomethyl)-1-ethoxy-3,4,5-trifluorobenzene?
The canonical SMILES for 2-(bromomethyl)-1-ethoxy-3,4,5-trifluorobenzene is CCOc1cc(F)c(F)c(F)c1CBr.
What is the InChIKey of 2-(bromomethyl)-1-ethoxy-3,4,5-trifluorobenzene?
The InChIKey is XJFNNXQODYHRHG-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H8BrF3O/c1-2-14-7-3-6(11)9(13)8(12)5(7)4-10/h3H,2,4H2,1H3.
What are the key properties of 2-(bromomethyl)-1-ethoxy-3,4,5-trifluorobenzene?
2-(bromomethyl)-1-ethoxy-3,4,5-trifluorobenzene has a molecular weight of 269.06 g/mol, XLogP of 3.40, 3 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(bromomethyl)-1-ethoxy-3,4,5-trifluorobenzene is sourced from PubChem (CID 122361199), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).