About (2'R,3R)-2'-(4-fluorophenyl)spiro[2H-1-benzofuran-3,5'-2H-furan]
(2'R,3R)-2'-(4-fluorophenyl)spiro[2H-1-benzofuran-3,5'-2H-furan] (PubChem CID 122361270) has the molecular formula C17H13FO2
and a molecular weight of 268.29 g/mol. Its IUPAC name is (2'R,3R)-2'-(4-fluorophenyl)spiro[2H-1-benzofuran-3,5'-2H-furan].
Molecular Properties
| Compound Name | (2'R,3R)-2'-(4-fluorophenyl)spiro[2H-1-benzofuran-3,5'-2H-furan] |
| PubChem CID | 122361270 |
| Molecular Formula | C17H13FO2 |
| Molecular Weight | 268.29 g/mol |
| Exact Mass | 268.09 |
| IUPAC Name | (2'R,3R)-2'-(4-fluorophenyl)spiro[2H-1-benzofuran-3,5'-2H-furan] |
| SMILES | Fc1ccc([C@H]2C=C[C@@]3(COc4ccccc43)O2)cc1 |
| InChI | InChI=1S/C17H13FO2/c18-13-7-5-12(6-8-13)15-9-10-17(20-15)11-19-16-4-2-1-3-14(16)17/h1-10,15H,11H2/t15-,17+/m1/s1 |
| InChIKey | XOIRHDNXRUDNST-WBVHZDCISA-N |
| XLogP | 3.74 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 268.29 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze (2'R,3R)-2'-(4-fluorophenyl)spiro[2H-1-benzofuran-3,5'-2H-furan] with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2'R,3R)-2'-(4-fluorophenyl)spiro[2H-1-benzofuran-3,5'-2H-furan]?
The IUPAC name of (2'R,3R)-2'-(4-fluorophenyl)spiro[2H-1-benzofuran-3,5'-2H-furan] (CID 122361270) is (2'R,3R)-2'-(4-fluorophenyl)spiro[2H-1-benzofuran-3,5'-2H-furan].
What is the SMILES notation for (2'R,3R)-2'-(4-fluorophenyl)spiro[2H-1-benzofuran-3,5'-2H-furan]?
The canonical SMILES for (2'R,3R)-2'-(4-fluorophenyl)spiro[2H-1-benzofuran-3,5'-2H-furan] is Fc1ccc([C@H]2C=C[C@@]3(COc4ccccc43)O2)cc1.
What is the InChIKey of (2'R,3R)-2'-(4-fluorophenyl)spiro[2H-1-benzofuran-3,5'-2H-furan]?
The InChIKey is XOIRHDNXRUDNST-WBVHZDCISA-N. The full InChI is InChI=1S/C17H13FO2/c18-13-7-5-12(6-8-13)15-9-10-17(20-15)11-19-16-4-2-1-3-14(16)17/h1-10,15H,11H2/t15-,17+/m1/s1.
What are the key properties of (2'R,3R)-2'-(4-fluorophenyl)spiro[2H-1-benzofuran-3,5'-2H-furan]?
(2'R,3R)-2'-(4-fluorophenyl)spiro[2H-1-benzofuran-3,5'-2H-furan] has a molecular weight of 268.29 g/mol, XLogP of 3.74, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (2'R,3R)-2'-(4-fluorophenyl)spiro[2H-1-benzofuran-3,5'-2H-furan] is sourced from PubChem (CID 122361270), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).