C18H18FNOS — CID 122361313
1-[(4R)-4-(4-fluorophenyl)-6,7-dihydro-4H-thieno[3,2-c]pyridin-5-yl]pent-4-en-1-one (PubChem CID 122361313) has the molecular formula C18H18FNOS and a molecular weight of 315.41 g/mol. Its IUPAC name is 1-[(4R)-4-(4-fluorophenyl)-6,7-dihydro-4H-thieno[3,2-c]pyridin-5-yl]pent-4-en-1-one.
| Compound Name | 1-[(4R)-4-(4-fluorophenyl)-6,7-dihydro-4H-thieno[3,2-c]pyridin-5-yl]pent-4-en-1-one |
|---|---|
| PubChem CID | 122361313 |
| Molecular Formula | C18H18FNOS |
| Molecular Weight | 315.41 g/mol |
| Exact Mass | 315.11 |
| IUPAC Name | 1-[(4R)-4-(4-fluorophenyl)-6,7-dihydro-4H-thieno[3,2-c]pyridin-5-yl]pent-4-en-1-one |
| SMILES | C=CCCC(=O)N1CCc2sccc2[C@H]1c1ccc(F)cc1 |
| InChI | InChI=1S/C18H18FNOS/c1-2-3-4-17(21)20-11-9-16-15(10-12-22-16)18(20)13-5-7-14(19)8-6-13/h2,5-8,10,12,18H,1,3-4,9,11H2/t18-/m1/s1 |
| InChIKey | QDGJVWXPEOFKEK-GOSISDBHSA-N |
| XLogP | 4.33 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.41 |
| LogP ≤ 5 | 4.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|