C17H28OSe — CID 122361348
(1S,2R,6R,9S,10S,13S,14S)-2,14-dimethyl-4-selenatetracyclo[7.7.0.02,6.010,14]hexadecan-13-ol (PubChem CID 122361348) has the molecular formula C17H28OSe and a molecular weight of 327.37 g/mol. Its IUPAC name is (1S,2R,6R,9S,10S,13S,14S)-2,14-dimethyl-4-selenatetracyclo[7.7.0.02,6.010,14]hexadecan-13-ol.
| Compound Name | (1S,2R,6R,9S,10S,13S,14S)-2,14-dimethyl-4-selenatetracyclo[7.7.0.02,6.010,14]hexadecan-13-ol |
|---|---|
| PubChem CID | 122361348 |
| Molecular Formula | C17H28OSe |
| Molecular Weight | 327.37 g/mol |
| Exact Mass | 328.13 |
| IUPAC Name | (1S,2R,6R,9S,10S,13S,14S)-2,14-dimethyl-4-selenatetracyclo[7.7.0.02,6.010,14]hexadecan-13-ol |
| SMILES | C[C@]12C[Se]C[C@@H]1CC[C@@H]1[C@@H]2CC[C@]2(C)[C@@H](O)CC[C@@H]12 |
| InChI | InChI=1S/C17H28OSe/c1-16-8-7-14-12(13(16)5-6-15(16)18)4-3-11-9-19-10-17(11,14)2/h11-15,18H,3-10H2,1-2H3/t11-,12-,13-,14-,15-,16-,17-/m0/s1 |
| InChIKey | FAGQITFREZZGBE-TYXVVTFGSA-N |
| XLogP | 3.76 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.37 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|