About 4-chloro-1H-imidazo[4,5-c]pyridine;hydrochloride
4-chloro-1H-imidazo[4,5-c]pyridine;hydrochloride (PubChem CID 122362446) has the molecular formula C6H5Cl2N3
and a molecular weight of 190.03 g/mol. Its IUPAC name is 4-chloro-1H-imidazo[4,5-c]pyridine;hydrochloride.
Molecular Properties
| Compound Name | 4-chloro-1H-imidazo[4,5-c]pyridine;hydrochloride |
| PubChem CID | 122362446 |
| Molecular Formula | C6H5Cl2N3 |
| Molecular Weight | 190.03 g/mol |
| Exact Mass | 188.99 |
| IUPAC Name | 4-chloro-1H-imidazo[4,5-c]pyridine;hydrochloride |
| SMILES | Cl.Clc1nccc2[nH]cnc12 |
| InChI | InChI=1S/C6H4ClN3.ClH/c7-6-5-4(1-2-8-6)9-3-10-5;/h1-3H,(H,9,10);1H |
| InChIKey | PWRPJPWNNRJQGO-UHFFFAOYSA-N |
| XLogP | 2.03 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 190.03 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|
Analyze 4-chloro-1H-imidazo[4,5-c]pyridine;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-chloro-1H-imidazo[4,5-c]pyridine;hydrochloride?
The IUPAC name of 4-chloro-1H-imidazo[4,5-c]pyridine;hydrochloride (CID 122362446) is 4-chloro-1H-imidazo[4,5-c]pyridine;hydrochloride.
What is the SMILES notation for 4-chloro-1H-imidazo[4,5-c]pyridine;hydrochloride?
The canonical SMILES for 4-chloro-1H-imidazo[4,5-c]pyridine;hydrochloride is Cl.Clc1nccc2[nH]cnc12.
What is the InChIKey of 4-chloro-1H-imidazo[4,5-c]pyridine;hydrochloride?
The InChIKey is PWRPJPWNNRJQGO-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H4ClN3.ClH/c7-6-5-4(1-2-8-6)9-3-10-5;/h1-3H,(H,9,10);1H.
What are the key properties of 4-chloro-1H-imidazo[4,5-c]pyridine;hydrochloride?
4-chloro-1H-imidazo[4,5-c]pyridine;hydrochloride has a molecular weight of 190.03 g/mol, XLogP of 2.03, 0 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-chloro-1H-imidazo[4,5-c]pyridine;hydrochloride is sourced from PubChem (CID 122362446), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).