C29H25F3N2O2 — CID 122362693
4-(4-methylphenyl)-6-oxo-2-[4-(3-phenylpropoxy)phenyl]-2-(trifluoromethyl)-1,3-dihydropyridine-5-carbonitrile (PubChem CID 122362693) has the molecular formula C29H25F3N2O2 and a molecular weight of 490.53 g/mol. Its IUPAC name is 4-(4-methylphenyl)-6-oxo-2-[4-(3-phenylpropoxy)phenyl]-2-(trifluoromethyl)-1,3-dihydropyridine-5-carbonitrile.
| Compound Name | 4-(4-methylphenyl)-6-oxo-2-[4-(3-phenylpropoxy)phenyl]-2-(trifluoromethyl)-1,3-dihydropyridine-5-carbonitrile |
|---|---|
| PubChem CID | 122362693 |
| Molecular Formula | C29H25F3N2O2 |
| Molecular Weight | 490.53 g/mol |
| Exact Mass | 490.19 |
| IUPAC Name | 4-(4-methylphenyl)-6-oxo-2-[4-(3-phenylpropoxy)phenyl]-2-(trifluoromethyl)-1,3-dihydropyridine-5-carbonitrile |
| SMILES | Cc1ccc(C2=C(C#N)C(=O)NC(c3ccc(OCCCc4ccccc4)cc3)(C(F)(F)F)C2)cc1 |
| InChI | InChI=1S/C29H25F3N2O2/c1-20-9-11-22(12-10-20)25-18-28(29(30,31)32,34-27(35)26(25)19-33)23-13-15-24(16-14-23)36-17-5-8-21-6-3-2-4-7-21/h2-4,6-7,9-16H,5,8,17-18H2,1H3,(H,34,35) |
| InChIKey | GWYUTJRXSWJAAZ-UHFFFAOYSA-N |
| XLogP | 6.26 |
| TPSA | 62.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.53 |
| LogP ≤ 5 | 6.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|