C32H30F6N2O3 — CID 122362713
4-(4-methylphenyl)-6-oxo-N-(2-phenylethyl)-2-[4-(4,4,4-trifluorobutoxy)phenyl]-2-(trifluoromethyl)-1,3-dihydropyridine-5-carboxamide (PubChem CID 122362713) has the molecular formula C32H30F6N2O3 and a molecular weight of 604.59 g/mol. Its IUPAC name is 4-(4-methylphenyl)-6-oxo-N-(2-phenylethyl)-2-[4-(4,4,4-trifluorobutoxy)phenyl]-2-(trifluoromethyl)-1,3-dihydropyridine-5-carboxamide.
| Compound Name | 4-(4-methylphenyl)-6-oxo-N-(2-phenylethyl)-2-[4-(4,4,4-trifluorobutoxy)phenyl]-2-(trifluoromethyl)-1,3-dihydropyridine-5-carboxamide |
|---|---|
| PubChem CID | 122362713 |
| Molecular Formula | C32H30F6N2O3 |
| Molecular Weight | 604.59 g/mol |
| Exact Mass | 604.22 |
| IUPAC Name | 4-(4-methylphenyl)-6-oxo-N-(2-phenylethyl)-2-[4-(4,4,4-trifluorobutoxy)phenyl]-2-(trifluoromethyl)-1,3-dihydropyridine-5-carboxamide |
| SMILES | Cc1ccc(C2=C(C(=O)NCCc3ccccc3)C(=O)NC(c3ccc(OCCCC(F)(F)F)cc3)(C(F)(F)F)C2)cc1 |
| InChI | InChI=1S/C32H30F6N2O3/c1-21-8-10-23(11-9-21)26-20-30(32(36,37)38,24-12-14-25(15-13-24)43-19-5-17-31(33,34)35)40-29(42)27(26)28(41)39-18-16-22-6-3-2-4-7-22/h2-4,6-15H,5,16-20H2,1H3,(H,39,41)(H,40,42) |
| InChIKey | RMLPETRTIGGOJW-UHFFFAOYSA-N |
| XLogP | 6.81 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 604.59 |
| LogP ≤ 5 | 6.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|