C30H26F6N2O3 — CID 122362715
4-(4-methylphenyl)-6-oxo-N-phenyl-2-[4-(4,4,4-trifluorobutoxy)phenyl]-2-(trifluoromethyl)-1,3-dihydropyridine-5-carboxamide (PubChem CID 122362715) has the molecular formula C30H26F6N2O3 and a molecular weight of 576.54 g/mol. Its IUPAC name is 4-(4-methylphenyl)-6-oxo-N-phenyl-2-[4-(4,4,4-trifluorobutoxy)phenyl]-2-(trifluoromethyl)-1,3-dihydropyridine-5-carboxamide.
| Compound Name | 4-(4-methylphenyl)-6-oxo-N-phenyl-2-[4-(4,4,4-trifluorobutoxy)phenyl]-2-(trifluoromethyl)-1,3-dihydropyridine-5-carboxamide |
|---|---|
| PubChem CID | 122362715 |
| Molecular Formula | C30H26F6N2O3 |
| Molecular Weight | 576.54 g/mol |
| Exact Mass | 576.18 |
| IUPAC Name | 4-(4-methylphenyl)-6-oxo-N-phenyl-2-[4-(4,4,4-trifluorobutoxy)phenyl]-2-(trifluoromethyl)-1,3-dihydropyridine-5-carboxamide |
| SMILES | Cc1ccc(C2=C(C(=O)Nc3ccccc3)C(=O)NC(c3ccc(OCCCC(F)(F)F)cc3)(C(F)(F)F)C2)cc1 |
| InChI | InChI=1S/C30H26F6N2O3/c1-19-8-10-20(11-9-19)24-18-28(30(34,35)36,21-12-14-23(15-13-21)41-17-5-16-29(31,32)33)38-27(40)25(24)26(39)37-22-6-3-2-4-7-22/h2-4,6-15H,5,16-18H2,1H3,(H,37,39)(H,38,40) |
| InChIKey | WOTADNPUQOERCL-UHFFFAOYSA-N |
| XLogP | 7.09 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 576.54 |
| LogP ≤ 5 | 7.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|