C23H18F6N2O2 — CID 122362726
6-oxo-4-phenyl-2-[4-(4,4,4-trifluorobutoxy)phenyl]-2-(trifluoromethyl)-1,3-dihydropyridine-5-carbonitrile (PubChem CID 122362726) has the molecular formula C23H18F6N2O2 and a molecular weight of 468.40 g/mol. Its IUPAC name is 6-oxo-4-phenyl-2-[4-(4,4,4-trifluorobutoxy)phenyl]-2-(trifluoromethyl)-1,3-dihydropyridine-5-carbonitrile.
| Compound Name | 6-oxo-4-phenyl-2-[4-(4,4,4-trifluorobutoxy)phenyl]-2-(trifluoromethyl)-1,3-dihydropyridine-5-carbonitrile |
|---|---|
| PubChem CID | 122362726 |
| Molecular Formula | C23H18F6N2O2 |
| Molecular Weight | 468.40 g/mol |
| Exact Mass | 468.13 |
| IUPAC Name | 6-oxo-4-phenyl-2-[4-(4,4,4-trifluorobutoxy)phenyl]-2-(trifluoromethyl)-1,3-dihydropyridine-5-carbonitrile |
| SMILES | N#CC1=C(c2ccccc2)CC(c2ccc(OCCCC(F)(F)F)cc2)(C(F)(F)F)NC1=O |
| InChI | InChI=1S/C23H18F6N2O2/c24-22(25,26)11-4-12-33-17-9-7-16(8-10-17)21(23(27,28)29)13-18(15-5-2-1-3-6-15)19(14-30)20(32)31-21/h1-3,5-10H,4,11-13H2,(H,31,32) |
| InChIKey | BQYWPMFOCUUFDZ-UHFFFAOYSA-N |
| XLogP | 5.66 |
| TPSA | 62.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.40 |
| LogP ≤ 5 | 5.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|