C28H26F6N4O3 — CID 122362736
N-(1-methylimidazol-4-yl)-4-(4-methylphenyl)-6-oxo-2-[4-(4,4,4-trifluorobutoxy)phenyl]-2-(trifluoromethyl)-1,3-dihydropyridine-5-carboxamide (PubChem CID 122362736) has the molecular formula C28H26F6N4O3 and a molecular weight of 580.53 g/mol. Its IUPAC name is N-(1-methylimidazol-4-yl)-4-(4-methylphenyl)-6-oxo-2-[4-(4,4,4-trifluorobutoxy)phenyl]-2-(trifluoromethyl)-1,3-dihydropyridine-5-carboxamide.
| Compound Name | N-(1-methylimidazol-4-yl)-4-(4-methylphenyl)-6-oxo-2-[4-(4,4,4-trifluorobutoxy)phenyl]-2-(trifluoromethyl)-1,3-dihydropyridine-5-carboxamide |
|---|---|
| PubChem CID | 122362736 |
| Molecular Formula | C28H26F6N4O3 |
| Molecular Weight | 580.53 g/mol |
| Exact Mass | 580.19 |
| IUPAC Name | N-(1-methylimidazol-4-yl)-4-(4-methylphenyl)-6-oxo-2-[4-(4,4,4-trifluorobutoxy)phenyl]-2-(trifluoromethyl)-1,3-dihydropyridine-5-carboxamide |
| SMILES | Cc1ccc(C2=C(C(=O)Nc3cn(C)cn3)C(=O)NC(c3ccc(OCCCC(F)(F)F)cc3)(C(F)(F)F)C2)cc1 |
| InChI | InChI=1S/C28H26F6N4O3/c1-17-4-6-18(7-5-17)21-14-26(28(32,33)34,19-8-10-20(11-9-19)41-13-3-12-27(29,30)31)37-25(40)23(21)24(39)36-22-15-38(2)16-35-22/h4-11,15-16H,3,12-14H2,1-2H3,(H,36,39)(H,37,40) |
| InChIKey | HGUPMKKHDOSHIE-UHFFFAOYSA-N |
| XLogP | 5.82 |
| TPSA | 85.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 580.53 |
| LogP ≤ 5 | 5.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|