C30H24F9NO3 — CID 122362741
4-(4-methylphenyl)-2-[4-(4,4,4-trifluorobutoxy)phenyl]-5-[4-(trifluoromethoxy)phenyl]-2-(trifluoromethyl)-1,3-dihydropyridin-6-one (PubChem CID 122362741) has the molecular formula C30H24F9NO3 and a molecular weight of 617.51 g/mol. Its IUPAC name is 4-(4-methylphenyl)-2-[4-(4,4,4-trifluorobutoxy)phenyl]-5-[4-(trifluoromethoxy)phenyl]-2-(trifluoromethyl)-1,3-dihydropyridin-6-one.
| Compound Name | 4-(4-methylphenyl)-2-[4-(4,4,4-trifluorobutoxy)phenyl]-5-[4-(trifluoromethoxy)phenyl]-2-(trifluoromethyl)-1,3-dihydropyridin-6-one |
|---|---|
| PubChem CID | 122362741 |
| Molecular Formula | C30H24F9NO3 |
| Molecular Weight | 617.51 g/mol |
| Exact Mass | 617.16 |
| IUPAC Name | 4-(4-methylphenyl)-2-[4-(4,4,4-trifluorobutoxy)phenyl]-5-[4-(trifluoromethoxy)phenyl]-2-(trifluoromethyl)-1,3-dihydropyridin-6-one |
| SMILES | Cc1ccc(C2=C(c3ccc(OC(F)(F)F)cc3)C(=O)NC(c3ccc(OCCCC(F)(F)F)cc3)(C(F)(F)F)C2)cc1 |
| InChI | InChI=1S/C30H24F9NO3/c1-18-3-5-19(6-4-18)24-17-27(29(34,35)36,21-9-13-22(14-10-21)42-16-2-15-28(31,32)33)40-26(41)25(24)20-7-11-23(12-8-20)43-30(37,38)39/h3-14H,2,15-17H2,1H3,(H,40,41) |
| InChIKey | DGAUUMYBINSHPH-UHFFFAOYSA-N |
| XLogP | 8.50 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 617.51 |
| LogP ≤ 5 | 8.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|