C26H23F6N3O2 — CID 122362752
5-imidazol-1-yl-4-(4-methylphenyl)-2-[4-(4,4,4-trifluorobutoxy)phenyl]-2-(trifluoromethyl)-1,3-dihydropyridin-6-one (PubChem CID 122362752) has the molecular formula C26H23F6N3O2 and a molecular weight of 523.48 g/mol. Its IUPAC name is 5-imidazol-1-yl-4-(4-methylphenyl)-2-[4-(4,4,4-trifluorobutoxy)phenyl]-2-(trifluoromethyl)-1,3-dihydropyridin-6-one.
| Compound Name | 5-imidazol-1-yl-4-(4-methylphenyl)-2-[4-(4,4,4-trifluorobutoxy)phenyl]-2-(trifluoromethyl)-1,3-dihydropyridin-6-one |
|---|---|
| PubChem CID | 122362752 |
| Molecular Formula | C26H23F6N3O2 |
| Molecular Weight | 523.48 g/mol |
| Exact Mass | 523.17 |
| IUPAC Name | 5-imidazol-1-yl-4-(4-methylphenyl)-2-[4-(4,4,4-trifluorobutoxy)phenyl]-2-(trifluoromethyl)-1,3-dihydropyridin-6-one |
| SMILES | Cc1ccc(C2=C(n3ccnc3)C(=O)NC(c3ccc(OCCCC(F)(F)F)cc3)(C(F)(F)F)C2)cc1 |
| InChI | InChI=1S/C26H23F6N3O2/c1-17-3-5-18(6-4-17)21-15-24(26(30,31)32,34-23(36)22(21)35-13-12-33-16-35)19-7-9-20(10-8-19)37-14-2-11-25(27,28)29/h3-10,12-13,16H,2,11,14-15H2,1H3,(H,34,36) |
| InChIKey | VBCCQMFRUOUCBZ-UHFFFAOYSA-N |
| XLogP | 6.26 |
| TPSA | 56.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 523.48 |
| LogP ≤ 5 | 6.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|