About 1-(4-Chlorophenyl)-2,2,2-trifluoroethanimine
1-(4-Chlorophenyl)-2,2,2-trifluoroethanimine (PubChem CID 12236288) has the molecular formula C8H5ClF3N
and a molecular weight of 207.58 g/mol. Its IUPAC name is 1-(4-chlorophenyl)-2,2,2-trifluoroethanimine.
Molecular Properties
| Compound Name | 1-(4-Chlorophenyl)-2,2,2-trifluoroethanimine |
| PubChem CID | 12236288 |
| Molecular Formula | C8H5ClF3N |
| Molecular Weight | 207.58 g/mol |
| Exact Mass | 207.01 |
| IUPAC Name | 1-(4-chlorophenyl)-2,2,2-trifluoroethanimine |
| SMILES | C1=CC(=CC=C1C(=N)C(F)(F)F)Cl |
| InChI | InChI=1S/C8H5ClF3N/c9-6-3-1-5(2-4-6)7(13)8(10,11)12/h1-4,13H |
| InChIKey | LYTLEAFGVZOXQL-UHFFFAOYSA-N |
| XLogP | 3.40 |
| TPSA | 23.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | 194 |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 207.58 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze 1-(4-Chlorophenyl)-2,2,2-trifluoroethanimine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(4-Chlorophenyl)-2,2,2-trifluoroethanimine?
The IUPAC name of 1-(4-Chlorophenyl)-2,2,2-trifluoroethanimine (CID 12236288) is 1-(4-chlorophenyl)-2,2,2-trifluoroethanimine.
What is the SMILES notation for 1-(4-Chlorophenyl)-2,2,2-trifluoroethanimine?
The canonical SMILES for 1-(4-Chlorophenyl)-2,2,2-trifluoroethanimine is C1=CC(=CC=C1C(=N)C(F)(F)F)Cl.
What is the InChIKey of 1-(4-Chlorophenyl)-2,2,2-trifluoroethanimine?
The InChIKey is LYTLEAFGVZOXQL-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H5ClF3N/c9-6-3-1-5(2-4-6)7(13)8(10,11)12/h1-4,13H.
What are the key properties of 1-(4-Chlorophenyl)-2,2,2-trifluoroethanimine?
1-(4-Chlorophenyl)-2,2,2-trifluoroethanimine has a molecular weight of 207.58 g/mol, XLogP of 3.40, 1 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(4-Chlorophenyl)-2,2,2-trifluoroethanimine is sourced from PubChem (CID 12236288), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).